Propanenitrile,3-[[(4-methylphenyl)sulfonyl]oxy]- structure
|
Common Name | Propanenitrile,3-[[(4-methylphenyl)sulfonyl]oxy]- | ||
|---|---|---|---|---|
| CAS Number | 34583-60-3 | Molecular Weight | 225.26400 | |
| Density | 1.249g/cm3 | Boiling Point | 408.9ºC at 760 mmHg | |
| Molecular Formula | C10H11NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 201.1ºC | |
| Name | 2-cyanoethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.249g/cm3 |
|---|---|
| Boiling Point | 408.9ºC at 760 mmHg |
| Molecular Formula | C10H11NO3S |
| Molecular Weight | 225.26400 |
| Flash Point | 201.1ºC |
| Exact Mass | 225.04600 |
| PSA | 75.54000 |
| LogP | 2.69478 |
| Index of Refraction | 1.531 |
| InChIKey | JRGDCDUZKXETSW-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCC#N)cc1 |
|
~%
Propanenitrile,... CAS#:34583-60-3 |
| Literature: Sakellarios Helvetica Chimica Acta, 1946 , vol. 29, p. 1675,1677, 1681 |
|
~%
Propanenitrile,... CAS#:34583-60-3 |
| Literature: Marshall,D.R. et al. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1977 , p. 1914 - 1919 |
| p-Tolylsulfonsaeure-2-cyanoaethylester |
| p-CH3C6H4-O2SO-CH2CH2CN |