1-(1-BENZOTHIOPHEN-2-YL)-2-BROMO-1-ETHANONE structure
|
Common Name | 1-(1-BENZOTHIOPHEN-2-YL)-2-BROMO-1-ETHANONE | ||
|---|---|---|---|---|
| CAS Number | 34586-27-1 | Molecular Weight | 185.60800 | |
| Density | 1.269g/cm3 | Boiling Point | 261.904ºC at 760 mmHg | |
| Molecular Formula | C8H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 112.196ºC | |
| Name | 1-(1-chloroethyl)-3-nitrobenzene |
|---|
| Density | 1.269g/cm3 |
|---|---|
| Boiling Point | 261.904ºC at 760 mmHg |
| Molecular Formula | C8H8ClNO2 |
| Molecular Weight | 185.60800 |
| Flash Point | 112.196ºC |
| Exact Mass | 185.02400 |
| PSA | 45.82000 |
| LogP | 3.41780 |
| Index of Refraction | 1.559 |
| InChIKey | QRWUNNJGVSGUAF-UHFFFAOYSA-N |
| SMILES | CC(Cl)c1cccc([N+](=O)[O-])c1 |
|
~92%
1-(1-BENZOTHIOP... CAS#:34586-27-1 |
| Literature: Hasan, Tayyaba; Sims, Leslie B.; Fry, Arthur Journal of the American Chemical Society, 1983 , vol. 105, # 12 p. 3967 - 3975 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |