3-(furan-2-yl)-2-naphthalen-1-ylpropanamide structure
|
Common Name | 3-(furan-2-yl)-2-naphthalen-1-ylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 3459-61-8 | Molecular Weight | 265.30700 | |
| Density | 1.217g/cm3 | Boiling Point | 470.1ºC at 760 mmHg | |
| Molecular Formula | C17H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.1ºC | |
| Name | 3-(furan-2-yl)-2-naphthalen-1-ylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 470.1ºC at 760 mmHg |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.30700 |
| Flash Point | 238.1ºC |
| Exact Mass | 265.11000 |
| PSA | 57.22000 |
| LogP | 4.39410 |
| Index of Refraction | 1.641 |
| InChIKey | DJIIKEYPSTUVKV-UHFFFAOYSA-N |
| SMILES | NC(=O)C(Cc1ccco1)c1cccc2ccccc12 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3-furan-2-yl-2-naphthalen-1-yl-propionamide |