2'-O-Acetylactein
Modify Date: 2025-09-01 18:04:56
2'-O-Acetylactein structure
|
Common Name | 2'-O-Acetylactein | ||
|---|---|---|---|---|
| CAS Number | 345968-83-4 | Molecular Weight | 718.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H58O12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2'-O-Acetylactein |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C39H58O12 |
|---|---|
| Molecular Weight | 718.9 |
| InChIKey | KWPBPWVYOWXHER-KBHPJZKOSA-N |
| SMILES | CC(=O)OC1C(OC2CCC34CC35CC(OC(C)=O)C3(C)C6C(C)CC7(OC6CC3(C)C5CCC4C2(C)C)OC(O)C2(C)OC72)OCC(O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2'-O-Acetylactein? |
| A: SMILES notation of 2'-O-Acetylactein is CC(=O)OC1C(OC2CCC34CC35CC(OC(C)=O)C3(C)C6C(C)CC7(OC6CC3(C)C5CCC4C2(C)C)OC(O)C2(C)OC72)OCC(O)C1O. |
| Q: What is the molecular weight of 2'-O-Acetylactein? |
| A: Molecular weight of 2'-O-Acetylactein is 718.9. |
| Q: What is the Chinese name of 345968-83-4? |
| A: Chinese name of 345968-83-4 is 345968-83-4. |
| Q: What is the molecular formula of 2'-O-Acetylactein? |
| A: Molecular formula of 2'-O-Acetylactein is C39H58O12. |
| Q: What is the CAS number of 2'-O-Acetylactein? |
| A: CAS number of 2'-O-Acetylactein is 345968-83-4. |
| Q: What is the English name of 2'-O-Acetylactein? |
| A: The English name of 2'-O-Acetylactein is 2'-O-Acetylactein. |
| Q: What is the InChIKey of 2'-O-Acetylactein? |
| A: InChIKey of 2'-O-Acetylactein is KWPBPWVYOWXHER-KBHPJZKOSA-N. |