1,2,3-Tribromo-5-nitrobenzene structure
|
Common Name | 1,2,3-Tribromo-5-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 3460-20-6 | Molecular Weight | 359.79800 | |
| Density | 2.401g/cm3 | Boiling Point | 344.5ºC at 760 mmHg | |
| Molecular Formula | C6H2Br3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.1ºC | |
| Name | 1,2,3-Tribromo-5-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.401g/cm3 |
|---|---|
| Boiling Point | 344.5ºC at 760 mmHg |
| Molecular Formula | C6H2Br3NO2 |
| Molecular Weight | 359.79800 |
| Flash Point | 162.1ºC |
| Exact Mass | 356.76400 |
| PSA | 45.82000 |
| LogP | 4.40550 |
| Index of Refraction | 1.668 |
| InChIKey | AKLYERMMCABILW-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)c(Br)c(Br)c1 |
| HS Code | 2904909090 |
|---|
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,2,3-Tribrom-5-nitro-benzol |
| Benzene,1,2,3-tribromo-5-nitro |
| 3,4,5-Tribromnitrobenzen |
| 3,4,5-Tribromnitrobenzol |
| 1,2,3-tribromo-5-nitro-benzene |
| 3,4,5-Tribromonitrobenzene |