4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one
![4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one Structure](https://image.chemsrc.com/caspic/147/34603-52-6.png)
4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one structure
|
Common Name | 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 34603-52-6 | Molecular Weight | 273.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H23NO2 |
|---|---|
| Molecular Weight | 273.37000 |
| Exact Mass | 273.17300 |
| PSA | 29.54000 |
| LogP | 2.80380 |
| InChIKey | OSVHQDWAYRACIL-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(CCN(C)C)C=CC(=O)CC2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 1 | |
CAS#:70503-69-4
CAS#:74-88-4
CAS#:14482-11-2
CAS#:123-11-5
CAS#:79214-90-7
CAS#:79214-89-4
CAS#:75523-04-5
CAS#:78-94-4
CAS#:60739-53-9
CAS#:66336-61-6
CAS#:6027-23-2This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one? |
| A: Molecular formula of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one is C17H23NO2. |
| Q: What is the molecular weight of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one? |
| A: Molecular weight of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one is 273.37000. |
| Q: What is the CAS number of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one? |
| A: CAS number of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one is 34603-52-6. |
| Q: What is the InChIKey of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one? |
| A: InChIKey of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one is OSVHQDWAYRACIL-UHFFFAOYSA-N. |
| Q: What is the English name of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one? |
| A: The English name of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one is 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one. |
| Q: What are the downstream products of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one? |
| A: Related downstream products(CAS) of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one: 6027-23-2. |
| Q: What is the polar surface area (PSA) of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one? |
| A: Polar surface area (PSA) of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one is 29.54000. |
| Q: What are the upstream materials of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one? |
| A: Related upstream materials(CAS) of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one: 70503-69-4;74-88-4;14482-11-2;123-11-5;79214-90-7;79214-89-4;75523-04-5;78-94-4;60739-53-9;66336-61-6. |
| Q: What is the LogP of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one? |
| A: LogP of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one is 2.80380. |
| Q: What is the SMILES notation of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one? |
| A: SMILES notation of 4-[2-(dimethylamino)ethyl]-4-(4-methoxyphenyl)cyclohex-2-en-1-one is COc1ccc(C2(CCN(C)C)C=CC(=O)CC2)cc1. |