ALLETHRINS structure
|
Common Name | ALLETHRINS | ||
|---|---|---|---|---|
| CAS Number | 34624-48-1 | Molecular Weight | 302.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(2-propenyl)-2-methyl-4-oxo-2-cyclopentenyl 2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylate |
|---|
| Molecular Formula | C19H26O3 |
|---|---|
| Molecular Weight | 302.40800 |
| Exact Mass | 302.18800 |
| PSA | 43.37000 |
| LogP | 4.00200 |
| InChIKey | ZCVAOQKBXKSDMS-XIRDDKMYSA-N |
| SMILES | C=CCC1=C(C)C(OC(=O)C2C(C=C(C)C)C2(C)C)CC1=O |
|
~%
ALLETHRINS CAS#:34624-48-1 |
| Literature: Schechter; Green; La Forge Journal of the American Chemical Society, 1949 , vol. 71, p. 3168 Gersdorff Soap santi. Chemicals, 1949 , vol. 25, # 11 p. 129,131, 139 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |