3-nitro-1,2,4,5-tetra(propan-2-yl)benzene structure
|
Common Name | 3-nitro-1,2,4,5-tetra(propan-2-yl)benzene | ||
|---|---|---|---|---|
| CAS Number | 3463-37-4 | Molecular Weight | 291.42800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H29NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-nitro-1,2,4,5-tetra(propan-2-yl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H29NO2 |
|---|---|
| Molecular Weight | 291.42800 |
| Exact Mass | 291.22000 |
| PSA | 45.82000 |
| LogP | 6.61160 |
| InChIKey | ONXAQGNTNNPSBY-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C(C)C)c(C(C)C)c([N+](=O)[O-])c1C(C)C |
| HS Code | 2904209090 |
|---|
|
~%
3-nitro-1,2,4,5... CAS#:3463-37-4 |
| Literature: Newton Journal of the American Chemical Society, 1943 , vol. 65, p. 2444 |
|
~%
Detail
|
| Literature: Newton Journal of the American Chemical Society, 1943 , vol. 65, p. 2444 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 2,3,5,6-Tetraisopropyl-nitro-benzol |
| 2,3,5,6-tetra-isopropylnitrobenzene |
| 1-Nitro-2,3,5,6-tetraisopropyl-benzol |
| 1,2,4,5-tetraisopropyl-3-nitro-benzene |
| 1,2,4,5-Tetraisopropyl-3-nitro-benzol |