1,4-dichloro-2,5-dimethyl-3-nitrobenzene structure
|
Common Name | 1,4-dichloro-2,5-dimethyl-3-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 3463-43-2 | Molecular Weight | 220.053 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 298.7±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H7Cl2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.5±25.9 °C | |
| Name | 1,4-dichloro-2,5-dimethyl-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 298.7±35.0 °C at 760 mmHg |
| Molecular Formula | C8H7Cl2NO2 |
| Molecular Weight | 220.053 |
| Flash Point | 134.5±25.9 °C |
| Exact Mass | 218.985382 |
| PSA | 45.82000 |
| LogP | 3.87 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | BGBKSOLUHNXPOJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c(C)c([N+](=O)[O-])c1Cl |
| HS Code | 2904909090 |
|---|
|
~%
1,4-dichloro-2,... CAS#:3463-43-2 |
| Literature: Wahl Annales de Chimie (Cachan, France), 1936 , vol. <11> 5, p. 5,42 |
|
~%
1,4-dichloro-2,... CAS#:3463-43-2 |
| Literature: Wahl Annales de Chimie (Cachan, France), vol. <11> 5, p. 54,59 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Benzene,1,4-dichloro-2,5-dimethyl-3-nitro |
| Benzene, 1,4-dichloro-2,5-dimethyl-3-nitro- |
| 2,5-dichloro-3-nitro-p-xylene |
| 1,4-dimethyl-2,5-dichloro-3-nitrobenzene |
| 1,4-dichloro-2,5-dimethyl-3-nitro-benzene |
| 1,4-Dichloro-2,5-dimethyl-3-nitrobenzene |
| 1,4-Dichlor-2,5-dimethyl-3-nitro-benzol |
| 3,6-Dichloro-2,5-dimethyl-nitrobenzene |