Spiro[9H-fluorene-9,3'-pyrrolidine]-2',5'-dione structure
|
Common Name | Spiro[9H-fluorene-9,3'-pyrrolidine]-2',5'-dione | ||
|---|---|---|---|---|
| CAS Number | 3464-16-2 | Molecular Weight | 249.26400 | |
| Density | 1.38g/cm3 | Boiling Point | 512.1ºC at 760 mmHg | |
| Molecular Formula | C16H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.6ºC | |
| Name | spiro[fluorene-9,3'-pyrrolidine]-2',5'-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 512.1ºC at 760 mmHg |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.26400 |
| Flash Point | 217.6ºC |
| Exact Mass | 249.07900 |
| PSA | 46.17000 |
| LogP | 2.32840 |
| Index of Refraction | 1.704 |
| InChIKey | VMZUIYAYMCCPTP-UHFFFAOYSA-N |
| SMILES | O=C1CC2(C(=O)N1)c1ccccc1-c1ccccc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Spiro[9H-fluorene-9,3'-pyrrolidine]-2',5'-dione |
| Spiro-(9H-fluoren-9,3'-succinimide) |
| Spiro(fluoren-9,3'-pyrrolidin)-2',5'-dion |