3-ethyl-3-phenylpyrrolidine-2,5-dione structure
|
Common Name | 3-ethyl-3-phenylpyrrolidine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 3464-20-8 | Molecular Weight | 203.23700 | |
| Density | 1.142g/cm3 | Boiling Point | 380.8ºC at 760 mmHg | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.8ºC | |
| Name | 3-ethyl-3-phenylpyrrolidine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 380.8ºC at 760 mmHg |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.23700 |
| Flash Point | 162.8ºC |
| Exact Mass | 203.09500 |
| PSA | 49.66000 |
| LogP | 1.65680 |
| Index of Refraction | 1.538 |
| InChIKey | FPDWKXNKXBTLKI-UHFFFAOYSA-N |
| SMILES | CCC1(c2ccccc2)CC(=O)NC1=O |
| HS Code | 2925190090 |
|---|
|
~%
3-ethyl-3-pheny... CAS#:3464-20-8 |
| Literature: Hoechster Farbw. Patent: DE389948 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 1257 |
|
~%
3-ethyl-3-pheny... CAS#:3464-20-8 |
| Literature: Hoechster Farbw. Patent: DE389948 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 1257 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Succinimide,2-ethyl-2-phenyl |
| 3-ethyl-3-phenyl-pyrrolidine-2,5-dione |
| 2,5-Dioxo-4-ethyl-4-phenylpyrrolidin |
| 5-Ethyl-5-phenylsuccinimide |
| 3-Aethyl-3-phenyl-pyrrolidin-2,5-dion |
| 3-ethyl-3-phenyl-2,5-pyrrolidinedione |
| 2-Ethyl-2-phenylsuccinimide |
| 2,5-Dioxo-3-ethyl-3-phenylpyrrolidin |