1-(4-ETHOXYPHENYL)-2-(4-MESYLPHENYL)ETHAN-1-ONE structure
|
Common Name | 1-(4-ETHOXYPHENYL)-2-(4-MESYLPHENYL)ETHAN-1-ONE | ||
|---|---|---|---|---|
| CAS Number | 346413-00-1 | Molecular Weight | 318.38700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H18O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-ethoxyphenyl)-2-(4-methylsulfonylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H18O4S |
|---|---|
| Molecular Weight | 318.38700 |
| Exact Mass | 318.09300 |
| PSA | 68.82000 |
| LogP | 3.99500 |
| InChIKey | KCFDBQJCUNNTHR-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)Cc2ccc(S(C)(=O)=O)cc2)cc1 |
| HS Code | 2914700090 |
|---|
|
~73%
1-(4-ETHOXYPHEN... CAS#:346413-00-1 |
| Literature: Wilkinson, Mark C. Organic Letters, 2011 , vol. 13, # 9 p. 2232 - 2235 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| qc-7552 |