2-(2-Chloro-4-ethylphenoxy)-5-methylbenzeneacetic acid structure
|
Common Name | 2-(2-Chloro-4-ethylphenoxy)-5-methylbenzeneacetic acid | ||
|---|---|---|---|---|
| CAS Number | 34643-09-9 | Molecular Weight | 304.76800 | |
| Density | 1.226g/cm3 | Boiling Point | 412.9ºC at 760 mmHg | |
| Molecular Formula | C17H17ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.5ºC | |
| Name | 2-[2-(2-chloro-4-ethylphenoxy)-5-methylphenyl]acetic acid |
|---|
| Density | 1.226g/cm3 |
|---|---|
| Boiling Point | 412.9ºC at 760 mmHg |
| Molecular Formula | C17H17ClO3 |
| Molecular Weight | 304.76800 |
| Flash Point | 203.5ºC |
| Exact Mass | 304.08700 |
| PSA | 46.53000 |
| LogP | 4.63020 |
| Index of Refraction | 1.583 |
| InChIKey | DTOBTMTUCDAZIZ-UHFFFAOYSA-N |
| SMILES | CCc1ccc(Oc2ccc(C)cc2CC(=O)O)c(Cl)c1 |
| HS Code | 2918990090 |
|---|
|
~%
2-(2-Chloro-4-e... CAS#:34643-09-9 |
| Literature: Atkinson, David C.; Godfrey, Keith E.; Meek, Bernard; Saville, John F.; Stillings, Michael R. Journal of Medicinal Chemistry, 1983 , vol. 26, # 10 p. 1353 - 1360 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |