Benzenamine,4-chloro-2-methyl-5-nitro structure
|
Common Name | Benzenamine,4-chloro-2-methyl-5-nitro | ||
|---|---|---|---|---|
| CAS Number | 34648-99-2 | Molecular Weight | 186.59600 | |
| Density | 1.415g/cm3 | Boiling Point | 369.2ºC at 760mmHg | |
| Molecular Formula | C7H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.1ºC | |
| Name | 4-chloro-2-methyl-5-nitroaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 369.2ºC at 760mmHg |
| Molecular Formula | C7H7ClN2O2 |
| Molecular Weight | 186.59600 |
| Flash Point | 177.1ºC |
| Exact Mass | 186.02000 |
| PSA | 71.84000 |
| LogP | 3.24320 |
| Index of Refraction | 1.627 |
| InChIKey | WUSAYXHDBDAHGU-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c([N+](=O)[O-])cc1N |
| HS Code | 2921430090 |
|---|
|
~89%
Benzenamine,4-c... CAS#:34648-99-2 |
| Literature: Zhang, Pingsheng; Cedilote, Miall; Cleary, Thomas P.; Pierce, Michael E. Tetrahedron Letters, 2007 , vol. 48, # 49 p. 8659 - 8664 |
|
~%
Benzenamine,4-c... CAS#:34648-99-2 |
| Literature: Reverdin; Crepieux Chemische Berichte, 1900 , vol. 33, p. 2505 |
|
~%
Benzenamine,4-c... CAS#:34648-99-2 |
| Literature: Reverdin; Crepieux Chemische Berichte, 1900 , vol. 33, p. 2505 |
|
~%
Benzenamine,4-c... CAS#:34648-99-2 |
| Literature: Reverdin; Crepieux Chemische Berichte, 1900 , vol. 33, p. 2505 |
|
~%
Benzenamine,4-c... CAS#:34648-99-2 |
| Literature: Kleiderer; Adams Journal of the American Chemical Society, 1933 , vol. 55, p. 4219,4221 |
|
~%
Benzenamine,4-c... CAS#:34648-99-2 |
| Literature: I.G.Farbenind. Patent: DE510306 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 16, p. 369 |
| Precursor 6 | |
|---|---|
| DownStream 5 | |
| HS Code | 2921430090 |
|---|---|
| Summary | HS:2921430090 toluidines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-Chlor-4-nitro-2-amino-toluol |
| 4-chloro-2-methyl-5-nitro-aniline |
| asymm.m-Nitro-p-chlor-o-toluidin |
| 4-Chlor-5-nitro-o-toluidin |
| 4-Chlor-2-methyl-5-nitro-anilin |
| 4-chloro-5-nitro-2-methylaniline |