2H-Benzo[a]quinolizin-2-ol, 3-ethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy- structure
|
Common Name | 2H-Benzo[a]quinolizin-2-ol, 3-ethyl-1,3,4,6,7,11b-hexahydro-9,10-dimethoxy- | ||
|---|---|---|---|---|
| CAS Number | 3466-76-0 | Molecular Weight | 291.38500 | |
| Density | 1.16g/cm3 | Boiling Point | 439.3ºC at 760 mmHg | |
| Molecular Formula | C17H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219.5ºC | |
| Name | 3-ethyl-9,10-dimethoxy-2,3,4,6,7,11b-hexahydro-1H-benzo[a]quinolizin-2-ol |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 439.3ºC at 760 mmHg |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.38500 |
| Flash Point | 219.5ºC |
| Exact Mass | 291.18300 |
| PSA | 41.93000 |
| LogP | 2.33170 |
| Index of Refraction | 1.574 |
| InChIKey | LYDWUTUOAGCHNM-UHFFFAOYSA-N |
| SMILES | CCC1CN2CCc3cc(OC)c(OC)cc3C2CC1O |
| HS Code | 2933990090 |
|---|
|
~%
2H-Benzo[a]quin... CAS#:3466-76-0 |
| Literature: Hoffmann-La Roche Patent: US2843591 , 1957 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |