4-(3-(Methylsulfonyl)phenyl)piperidine structure
|
Common Name | 4-(3-(Methylsulfonyl)phenyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 346688-72-0 | Molecular Weight | 239.33400 | |
| Density | 1.148g/cm3 | Boiling Point | 425.343ºC at 760 mmHg | |
| Molecular Formula | C12H17NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.04ºC | |
| Name | 4-(3-methylsulfonylphenyl)piperidine |
|---|
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 425.343ºC at 760 mmHg |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.33400 |
| Flash Point | 211.04ºC |
| Exact Mass | 239.09800 |
| PSA | 54.55000 |
| LogP | 2.96670 |
| Index of Refraction | 1.535 |
| InChIKey | BFFDEVPWGSZYSN-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)c1cccc(C2CCNCC2)c1 |
|
~84%
4-(3-(Methylsul... CAS#:346688-72-0 |
| Literature: Pettersson, Fredrik; Ponten, Henrik; Waters, Nicholas; Waters, Susanna; Sonesson, Clas Journal of Medicinal Chemistry, 2010 , vol. 53, # 6 p. 2510 - 2520 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |