2-THIOXO-2,3-DIHYDROPYRAZOLO[1,5-A][1,3,5]TRIAZIN-4(1H)-ONE structure
|
Common Name | 2-THIOXO-2,3-DIHYDROPYRAZOLO[1,5-A][1,3,5]TRIAZIN-4(1H)-ONE | ||
|---|---|---|---|---|
| CAS Number | 34682-99-0 | Molecular Weight | 168.17600 | |
| Density | 1.937g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C5H4N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-sulfanylidene-6H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.937g/cm3 |
|---|---|
| Molecular Formula | C5H4N4OS |
| Molecular Weight | 168.17600 |
| Exact Mass | 168.01100 |
| PSA | 98.04000 |
| LogP | 0.08020 |
| Index of Refraction | 1.945 |
| InChIKey | YSSDVMSKYUWULF-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=S)nc2cc[nH]n12 |
| HS Code | 2933990090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Oxo-2-thioxo-1H,3H-pyrazolo<1,5-a>-1,3,5-triazin |