ethyl N-(2H-1,2,4-triazol-3-ylthiocarbamoyl)carbamate structure
|
Common Name | ethyl N-(2H-1,2,4-triazol-3-ylthiocarbamoyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 34683-38-0 | Molecular Weight | 215.23300 | |
| Density | 1.532g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H9N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl N-(1H-1,2,4-triazol-5-ylcarbamothioyl)carbamate |
|---|
| Density | 1.532g/cm3 |
|---|---|
| Molecular Formula | C6H9N5O2S |
| Molecular Weight | 215.23300 |
| Exact Mass | 215.04800 |
| PSA | 124.02000 |
| LogP | 0.71150 |
| Index of Refraction | 1.679 |
| InChIKey | XKAZAIVHEVHREV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)NC(=S)Nc1ncn[nH]1 |
|
~%
ethyl N-(2H-1,2... CAS#:34683-38-0 |
| Literature: Bera, Hriday; Dolzhenko, Anton V.; Sun, Lingyi; Dutta Gupta, Sayan; Chui, Wai-Keung Chemical Biology and Drug Design, 2013 , vol. 82, # 3 p. 351 - 360 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |