ETHYL 5-METHOXY-1H-PYRROLO[2, 3-C]PYRIDINE-2-CARBOXYLATE
![ETHYL 5-METHOXY-1H-PYRROLO[2, 3-C]PYRIDINE-2-CARBOXYLATE Structure](https://image.chemsrc.com/caspic/049/3469-63-4.png)
ETHYL 5-METHOXY-1H-PYRROLO[2, 3-C]PYRIDINE-2-CARBOXYLATE structure
|
Common Name | ETHYL 5-METHOXY-1H-PYRROLO[2, 3-C]PYRIDINE-2-CARBOXYLATE | ||
|---|---|---|---|---|
| CAS Number | 3469-63-4 | Molecular Weight | 220.225 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 384.4±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.3±26.5 °C | |
Summary: Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate (CAS号：3469-63-4) is a chemical reagent with molecular formula C11H12N2O3 and molecular weight 220.225. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 384.4±37.0 °C at 760 mmHg |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.225 |
| Flash Point | 186.3±26.5 °C |
| Exact Mass | 220.084793 |
| PSA | 64.21000 |
| LogP | 2.11 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | HHISWAOZOHNXMF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2cc(OC)ncc2[nH]1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
CAS#:3469-62-3
CAS#:6635-90-1
CAS#:23056-33-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| C-2042 |
| 5-Methoxy-6-aza-indol-2-carbonsaeureethylester |
| Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate |
| HIN1710 |
| Ethyl-5-methoxy-6-azaindol-2-carboxylat |
| 5-Methoxy-6-azaindol-2-carboxylat |
| Y8811 |
| 1H-Pyrrolo[2,3-c]pyridine-2-carboxylic acid, 5-methoxy-, ethyl ester |
| 5-Methoxy-6-azaindole-2-ethylcarboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate? |
| A: Molecular formula of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate is C11H12N2O3. |
| Q: What is the English name of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate? |
| A: The English name of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate is Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate. |
| Q: What is the CAS number of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate? |
| A: CAS number of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate is 3469-63-4. |
| Q: What is the LogP of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate? |
| A: LogP of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate is 2.11. |
| Q: What is the InChIKey of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate? |
| A: InChIKey of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate is HHISWAOZOHNXMF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate? |
| A: SMILES notation of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate is CCOC(=O)c1cc2cc(OC)ncc2[nH]1. |
| Q: What are the upstream materials of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate? |
| A: Related upstream materials(CAS) of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate: 3469-62-3;6635-90-1;23056-33-9. |
| Q: What is the polar surface area (PSA) of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate? |
| A: Polar surface area (PSA) of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate is 64.21000. |
| Q: What is the boiling point of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate? |
| A: Boiling point of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate is 384.4±37.0 °C at 760 mmHg. |
| Q: What is the molecular weight of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate? |
| A: Molecular weight of Ethyl 5-methoxy-1H-pyrrolo[2,3-c]pyridine-2-carboxylate is 220.225. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |