2-Iodo-3,4,5,6-tetramethylbenzoic acid
Modify Date: 2025-10-31 17:14:37
2-Iodo-3,4,5,6-tetramethylbenzoic acid structure
|
Common Name | 2-Iodo-3,4,5,6-tetramethylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 34701-88-7 | Molecular Weight | 304.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13IO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Iodo-3,4,5,6-tetramethylbenzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H13IO2 |
|---|---|
| Molecular Weight | 304.12 |
| InChIKey | NGAXPYOVWNQKBI-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(C)c(C(=O)O)c(I)c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Iodo-3,4,5,6-tetramethylbenzoic acid? |
| A: InChIKey of 2-Iodo-3,4,5,6-tetramethylbenzoic acid is NGAXPYOVWNQKBI-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 2-Iodo-3,4,5,6-tetramethylbenzoic acid? |
| A: Molecular formula of 2-Iodo-3,4,5,6-tetramethylbenzoic acid is C11H13IO2. |
| Q: What is the English name of 2-Iodo-3,4,5,6-tetramethylbenzoic acid? |
| A: The English name of 2-Iodo-3,4,5,6-tetramethylbenzoic acid is 2-Iodo-3,4,5,6-tetramethylbenzoic acid. |
| Q: What is the CAS number of 2-Iodo-3,4,5,6-tetramethylbenzoic acid? |
| A: CAS number of 2-Iodo-3,4,5,6-tetramethylbenzoic acid is 34701-88-7. |
| Q: What is the SMILES notation of 2-Iodo-3,4,5,6-tetramethylbenzoic acid? |
| A: SMILES notation of 2-Iodo-3,4,5,6-tetramethylbenzoic acid is Cc1c(C)c(C)c(C(=O)O)c(I)c1C. |
| Q: What is the Chinese name of 34701-88-7? |
| A: Chinese name of 34701-88-7 is 34701-88-7. |
| Q: What is the molecular weight of 2-Iodo-3,4,5,6-tetramethylbenzoic acid? |
| A: Molecular weight of 2-Iodo-3,4,5,6-tetramethylbenzoic acid is 304.12. |