6H-Indolo(2,3-b)quinoxaline, 2,3-dichloro- structure
|
Common Name | 6H-Indolo(2,3-b)quinoxaline, 2,3-dichloro- | ||
|---|---|---|---|---|
| CAS Number | 34712-15-7 | Molecular Weight | 288.13100 | |
| Density | 1.596g/cm3 | Boiling Point | 541ºC at 760 mmHg | |
| Molecular Formula | C14H7Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.2ºC | |
| Name | 2,3-dichloro-6H-indolo[3,2-b]quinoxaline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.596g/cm3 |
|---|---|
| Boiling Point | 541ºC at 760 mmHg |
| Molecular Formula | C14H7Cl2N3 |
| Molecular Weight | 288.13100 |
| Flash Point | 311.2ºC |
| Exact Mass | 287.00200 |
| PSA | 41.57000 |
| LogP | 4.57110 |
| Index of Refraction | 1.843 |
| InChIKey | NMCOVSLCEMGHKK-UHFFFAOYSA-N |
| SMILES | Clc1cc2nc3[nH]c4ccccc4c3nc2cc1Cl |
| HS Code | 2933990090 |
|---|
|
~%
6H-Indolo(2,3-b... CAS#:34712-15-7 |
| Literature: Li, Wengang; Samra, Dina Abu; Merzaban, Jasmeen; Khashab, Niveen M. Journal of Nanoscience and Nanotechnology, 2013 , vol. 13, # 2 p. 1399 - 1402 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,3-dichloro-6H-indolo[2,3-b]quinoxaline |
| HMS623B15 |
| 6H-Indolo(2,3-b)quinoxaline,2,3-dichloro |
| 2,3-Dichloro-indophenazin |