Phenyl N-{4-[(6,7-Dimethoxy-4-quinolyl)oxy]phenyl}carbamate structure
|
Common Name | Phenyl N-{4-[(6,7-Dimethoxy-4-quinolyl)oxy]phenyl}carbamate | ||
|---|---|---|---|---|
| CAS Number | 347151-53-5 | Molecular Weight | 416.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Phenyl N-{4-[(6,7-Dimethoxy-4-quinolyl)oxy]phenyl}carbamate |
|---|
| Molecular Formula | C24H20N2O5 |
|---|---|
| Molecular Weight | 416.4 |
| InChIKey | KVDZJYLUBBYJIX-UHFFFAOYSA-N |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)Oc4ccccc4)cc3)c2cc1OC |
|
Name: Inhibition of PDGFR alpha phosphorylation in G292 cell
Source: ChEMBL
Target: Platelet-derived growth factor receptor alpha
External Id: CHEMBL860933
|
|
Name: Inhibition of c-kit receptor phosphorylation in M07e cell
Source: ChEMBL
Target: Mast/stem cell growth factor receptor Kit
External Id: CHEMBL860934
|