1-(3,5-dichlorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde structure
|
Common Name | 1-(3,5-dichlorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 347331-67-3 | Molecular Weight | 268.13900 | |
| Density | 1.27g/cm3 | Boiling Point | 411.1ºC at 760mmHg | |
| Molecular Formula | C13H11Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 1-(3,5-dichlorophenyl)-2,5-dimethylpyrrole-3-carbaldehyde |
|---|
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 411.1ºC at 760mmHg |
| Molecular Formula | C13H11Cl2NO |
| Molecular Weight | 268.13900 |
| Flash Point | 202.4ºC |
| Exact Mass | 267.02200 |
| PSA | 22.00000 |
| LogP | 4.21340 |
| Index of Refraction | 1.591 |
| InChIKey | KVBRPHMQEKHDLF-UHFFFAOYSA-N |
| SMILES | Cc1cc(C=O)c(C)n1-c1cc(Cl)cc(Cl)c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |