Benzenepentanoic acid,3,4,5-trimethoxy-d-oxo- structure
|
Common Name | Benzenepentanoic acid,3,4,5-trimethoxy-d-oxo- | ||
|---|---|---|---|---|
| CAS Number | 34759-04-1 | Molecular Weight | 282.28900 | |
| Density | 1.19g/cm3 | Boiling Point | 468.7ºC at 760mmHg | |
| Molecular Formula | C14H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.2ºC | |
| Name | 5-oxo-5-(3,4,5-trimethoxyphenyl)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 468.7ºC at 760mmHg |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.28900 |
| Flash Point | 174.2ºC |
| Exact Mass | 282.11000 |
| PSA | 82.06000 |
| LogP | 2.15000 |
| Index of Refraction | 1.517 |
| InChIKey | LGYXZGUQHIJKTR-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)CCCC(=O)O)cc(OC)c1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(3,4,5-trimethoxybenzoyl)butanoic acid |
| 5-Oxo-5-(3,4,5-trimethoxy-phenyl)-valeriansaeure |
| 5-oxo-5-(3,4,5-trimethoxy-phenyl)-valeric acid |
| 5-(3,4,5-TRIMETHOXYPHENYL)-5-OXOVALERIC ACID |