2,7-dibromooctanedioic acid
Modify Date: 2025-08-29 14:19:02
2,7-dibromooctanedioic acid structure
|
Common Name | 2,7-dibromooctanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 3479-82-1 | Molecular Weight | 331.98600 | |
| Density | 1.876g/cm3 | Boiling Point | 423.8ºC at 760 mmHg | |
| Molecular Formula | C8H12Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.1ºC | |
| Name | 2,7-dibromooctanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.876g/cm3 |
|---|---|
| Boiling Point | 423.8ºC at 760 mmHg |
| Molecular Formula | C8H12Br2O4 |
| Molecular Weight | 331.98600 |
| Flash Point | 210.1ºC |
| Exact Mass | 329.91000 |
| PSA | 74.60000 |
| LogP | 2.24300 |
| Index of Refraction | 1.564 |
| InChIKey | DWXFXWYNVJXVQQ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(Br)CCCCC(Br)C(=O)O |
| HS Code | 2917190090 |
|---|
|
~%
2,7-dibromoocta... CAS#:3479-82-1 |
| Literature: Goss; Ingold Journal of the Chemical Society, 1926 , p. 1474 |
|
~%
2,7-dibromoocta... CAS#:3479-82-1 |
| Literature: Goss; Ingold Journal of the Chemical Society, 1926 , p. 1474 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,7-Dibrom-octandisaeure |
| 2,7-dibromo-octanedioic acid |