N-(1-phenylethyl)benzamide structure
|
Common Name | N-(1-phenylethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 3480-59-9 | Molecular Weight | 225.28600 | |
| Density | 1.084g/cm3 | Boiling Point | 422.8ºC at 760 mmHg | |
| Molecular Formula | C15H15NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.9ºC | |
| Name | N-(1-phenylethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.084g/cm3 |
|---|---|
| Boiling Point | 422.8ºC at 760 mmHg |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.28600 |
| Flash Point | 254.9ºC |
| Exact Mass | 225.11500 |
| PSA | 32.59000 |
| LogP | 3.75240 |
| Index of Refraction | 1.578 |
| InChIKey | FALTVGCCGMDSNZ-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)c1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (1-phenylethyl)benzamide |
| N-(1-phenyl)ethylbenzamide |
| N-(1-phenethyl)benzamide |