Benzamide, 2-amino-5-bromo-N-(2-methylpropyl)
Modify Date: 2026-09-26 23:22:27
Benzamide, 2-amino-5-bromo-N-(2-methylpropyl) structure
|
Common Name | Benzamide, 2-amino-5-bromo-N-(2-methylpropyl) | ||
|---|---|---|---|---|
| CAS Number | 34810-95-2 | Molecular Weight | 271.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15BrN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzamide, 2-amino-5-bromo-N-(2-methylpropyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15BrN2O |
|---|---|
| Molecular Weight | 271.15 |
| InChIKey | BQSNZVKMBJWGCT-UHFFFAOYSA-N |
| SMILES | CC(C)CNC(=O)c1cc(Br)ccc1N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl)? |
| A: The English name of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl) is Benzamide, 2-amino-5-bromo-N-(2-methylpropyl). |
| Q: What is the molecular weight of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl)? |
| A: Molecular weight of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl) is 271.15. |
| Q: What is the CAS number of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl)? |
| A: CAS number of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl) is 34810-95-2. |
| Q: What is the Chinese name of 34810-95-2? |
| A: Chinese name of 34810-95-2 is 34810-95-2. |
| Q: What is the InChIKey of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl)? |
| A: InChIKey of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl) is BQSNZVKMBJWGCT-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl)? |
| A: Molecular formula of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl) is C11H15BrN2O. |
| Q: What is the SMILES notation of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl)? |
| A: SMILES notation of Benzamide, 2-amino-5-bromo-N-(2-methylpropyl) is CC(C)CNC(=O)c1cc(Br)ccc1N. |