2-(hydroxymethyl)-5-(5-methylsulfanyl-4,7,9-triazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)oxolane-3,4-diol structure
|
Common Name | 2-(hydroxymethyl)-5-(5-methylsulfanyl-4,7,9-triazabicyclo[4.3.0]nona-2,4,7,10-tetraen-9-yl)oxolane-3,4-diol | ||
|---|---|---|---|---|
| CAS Number | 3483-02-1 | Molecular Weight | 297.33000 | |
| Density | 1.72g/cm3 | Boiling Point | 639.9ºC at 760 mmHg | |
| Molecular Formula | C12H15N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 340.8ºC | |
| Name | (11S,12S)-3-methyl-1,2,11,12-tetrahydrobenzo[j]aceanthrylene-11,12-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 639.9ºC at 760 mmHg |
| Molecular Formula | C12H15N3O4S |
| Molecular Weight | 297.33000 |
| Flash Point | 340.8ºC |
| Exact Mass | 297.07800 |
| PSA | 125.93000 |
| Index of Refraction | 1.772 |
| InChIKey | BEEXSNOLLGMOAT-UHFFFAOYSA-N |
| SMILES | CSc1nccc2c1ncn2C1OC(CO)C(O)C1O |
|
~73%
2-(hydroxymethy... CAS#:3483-02-1 |
| Literature: Krenitsky; Rideout; Chao; Koszalka; Gurney; Crouch; Cohn; Wolberg; Vinegar Journal of Medicinal Chemistry, 1986 , vol. 29, # 1 p. 138 - 143 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Indeno(1,2-C)pyrazol-4(2H)-one,3-methyl-2-(4-methyl-2-quinolinyl) |
| 3-Methyl-1-(4-methyl-2-quinolinyl)indeno(1,2-c)pyrazol-4(1H)-one |
| Indeno(1,2-c)pyrazol-4(1H)-one,3-methyl-1-(4-methyl-2-quinolinyl) |
| 1-(4'-methylquinol-2-yl)-3-methyl-indeno<1,2-c>pyrazol-(1H)-4-one |
| 3-methyl-1-(4-methylquinolin-2-yl)indeno[1,2-c]pyrazol-4(1h)-one |