oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride
![oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride Structure](https://image.chemsrc.com/caspic/442/34849-23-5.png)
oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride structure
|
Common Name | oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 34849-23-5 | Molecular Weight | 237.68200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H12ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride, also known as 2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-ylacetyl chloride, has a CAS number of 34849-23-5, with a molecular formula of C12H12ClNO2 and a molecular weight of 237.68200. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H12ClNO2 |
|---|---|
| Molecular Weight | 237.68200 |
| Exact Mass | 237.05600 |
| PSA | 37.38000 |
| LogP | 2.18630 |
| InChIKey | UVSOVGQCMPWKMM-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(=O)N1CCCCc2ccccc21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4425-15-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| oxo-(2,3,4,5-tetrahydro-benzo[b]azepin-1-yl)-acetyl chloride |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride? |
| A: Related downstream products(CAS) of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride: 4425-15-4. |
| Q: What is the molecular weight of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride? |
| A: Molecular weight of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride is 237.68200. |
| Q: What is the English name of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride? |
| A: The English name of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride is oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride. |
| Q: What is the CAS number of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride? |
| A: CAS number of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride is 34849-23-5. |
| Q: What is the LogP of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride? |
| A: LogP of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride is 2.18630. |
| Q: What English synonyms does oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride have? |
| A: English synonyms of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride: oxo-(2,3,4,5-tetrahydro-benzo[b]azepin-1-yl)-acetyl chloride. |
| Q: What is the Chinese name of 34849-23-5? |
| A: Chinese name of 34849-23-5 is 34849-23-5. |
| Q: What is the molecular formula of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride? |
| A: Molecular formula of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride is C12H12ClNO2. |
| Q: What is the InChIKey of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride? |
| A: InChIKey of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride is UVSOVGQCMPWKMM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride? |
| A: SMILES notation of oxo-(2,3,4,5-tetrahydro-1H-benzo[b]azepin-1-yl)acetyl chloride is O=C(Cl)C(=O)N1CCCCc2ccccc21. |