(2-acetyl-4-bromophenoxy)acetic acid ethyl ester
(2-acetyl-4-bromophenoxy)acetic acid ethyl ester structure
|
Common Name | (2-acetyl-4-bromophenoxy)acetic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 34849-50-8 | Molecular Weight | 301.13300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: (2-Acetyl-4-bromophenoxy)acetic acid ethyl ester, CAS号34849-50-8, molecular formula C12H13BrO4, molecular weight 301.13300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2-acetyl-4-bromophenoxy)acetic acid ethyl ester |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H13BrO4 |
|---|---|
| Molecular Weight | 301.13300 |
| Exact Mass | 300.00000 |
| PSA | 52.60000 |
| LogP | 2.59360 |
| InChIKey | NGJROWIAIGCUGO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COc1ccc(Br)cc1C(C)=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:33118-85-3
CAS#:50638-08-9This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| (2-acetyl-4-bromo-phenoxy)-acetic acid ethyl ester |
| ethyl (2-acetyl-4-bromophenyl)oxyacetate |
| ethyl (2-acetyl-4-bromophenoxy)acetate |
| ethyl 2-(2-acetyl-4-bromophenoxy)acetate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does (2-acetyl-4-bromophenoxy)acetic acid ethyl ester have? |
| A: English synonyms of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester: (2-acetyl-4-bromo-phenoxy)-acetic acid ethyl ester, ethyl (2-acetyl-4-bromophenyl)oxyacetate, ethyl (2-acetyl-4-bromophenoxy)acetate, ethyl 2-(2-acetyl-4-bromophenoxy)acetate. |
| Q: What is the Chinese name of 34849-50-8? |
| A: Chinese name of 34849-50-8 is 34849-50-8. |
| Q: What is the molecular formula of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester? |
| A: Molecular formula of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester is C12H13BrO4. |
| Q: What is the molecular weight of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester? |
| A: Molecular weight of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester is 301.13300. |
| Q: What is the CAS number of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester? |
| A: CAS number of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester is 34849-50-8. |
| Q: What is the English name of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester? |
| A: The English name of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester is (2-acetyl-4-bromophenoxy)acetic acid ethyl ester. |
| Q: What are the downstream products of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester? |
| A: Related downstream products(CAS) of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester: 33118-85-3;50638-08-9. |
| Q: What is the SMILES notation of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester? |
| A: SMILES notation of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester is CCOC(=O)COc1ccc(Br)cc1C(C)=O. |
| Q: What is the LogP of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester? |
| A: LogP of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester is 2.59360. |
| Q: What is the polar surface area (PSA) of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester? |
| A: Polar surface area (PSA) of (2-acetyl-4-bromophenoxy)acetic acid ethyl ester is 52.60000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |