1H-Purine-2,6-dione,3,9-dihydro-1,3-dimethyl-, sodium salt (1:1)
1H-Purine-2,6-dione,3,9-dihydro-1,3-dimethyl-, sodium salt (1:1) structure
|
Common Name | 1H-Purine-2,6-dione,3,9-dihydro-1,3-dimethyl-, sodium salt (1:1) | ||
|---|---|---|---|---|
| CAS Number | 3485-82-3 | Molecular Weight | 202.14600 | |
| Density | N/A | Boiling Point | 271.1ºC at 760mmHg | |
| Molecular Formula | C7H7N4NaO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 271.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C7H7N4NaO2 |
| Molecular Weight | 202.14600 |
| Flash Point | 117.8ºC |
| Exact Mass | 202.04700 |
| PSA | 69.78000 |
| InChIKey | QVGLHVDBDYLFON-UHFFFAOYSA-M |
| SMILES | Cn1c(=O)c2[n-]cnc2n(C)c1=O.[Na+] |
This table summarizes toxicological test data, acute & chronic toxicity and ecological hazard parameters for this chemical.
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2933990090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:137046-51-6
CAS#:59663-15-9This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Purine-2,6-dione,3,7-dihydro-1,3-dimethyl-,sodium salt |
| sodium salt of theophylline |
| Einecs 222-472-9 |
| 1,3-DIMETHYLXANTHINE SODIUM SALT |
| sodium thiophyllinate |
| heophylline,sodium deriv. |
| 6-dione,3,7-dihydro-1,3-dimethyl-1h-purine-sodium salt |
| Theophyllinesodiumsalt |
| sodium theophylline |
| 1H-Purine-2,6-dione,3,9-dihydro-1,3-dimethyl-,sodium salt (1:1) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What English synonyms does 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt have? |
| A: English synonyms of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt: 1H-Purine-2,6-dione,3,7-dihydro-1,3-dimethyl-,sodium salt, sodium salt of theophylline, Einecs 222-472-9, 1,3-DIMETHYLXANTHINE SODIUM SALT, sodium thiophyllinate, heophylline,sodium deriv., 6-dione,3,7-dihydro-1,3-dimethyl-1h-purine-sodium salt, Theophyllinesodiumsalt, sodium theophylline, 1H-Purine-2,6-dione,3,9-dihydro-1,3-dimethyl-,sodium salt (1:1). |
| Q: What is the CAS number of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt? |
| A: CAS number of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt is 3485-82-3. |
| Q: What are the downstream products of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt? |
| A: Related downstream products(CAS) of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt: 137046-51-6;59663-15-9. |
| Q: What is the boiling point of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt? |
| A: Boiling point of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt is 271.1ºC at 760mmHg. |
| Q: What is the molecular weight of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt? |
| A: Molecular weight of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt is 202.14600. |
| Q: What is the polar surface area (PSA) of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt? |
| A: Polar surface area (PSA) of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt is 69.78000. |
| Q: What is the SMILES notation of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt? |
| A: SMILES notation of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt is Cn1c(=O)c2[n-]cnc2n(C)c1=O.[Na+]. |
| Q: What is the Chinese name of 3485-82-3? |
| A: Chinese name of 3485-82-3 is 3485-82-3. |
| Q: What is the English name of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt? |
| A: The English name of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt is 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt. |
| Q: What is the molecular formula of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt? |
| A: Molecular formula of 3,7-dihydro-1,3-dimethyl-1H-purine-2,6-dione, sodium salt is C7H7N4NaO2. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |