1H-Pyrrolo[2,3-b]pyridine, 4-methoxy-1-[(4-methylphenyl)sulfonyl]- structure
|
Common Name | 1H-Pyrrolo[2,3-b]pyridine, 4-methoxy-1-[(4-methylphenyl)sulfonyl]- | ||
|---|---|---|---|---|
| CAS Number | 348640-52-8 | Molecular Weight | 302.34800 | |
| Density | 1.32g/cm3 | Boiling Point | 472.088ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.31ºC | |
| Name | 1H-Pyrrolo[2,3-b]pyridine, 4-methoxy-1-[(4-methylphenyl)sulfonyl] |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 472.088ºC at 760 mmHg |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.34800 |
| Flash Point | 239.31ºC |
| Exact Mass | 302.07300 |
| PSA | 69.57000 |
| LogP | 3.67110 |
| Index of Refraction | 1.633 |
| InChIKey | QSMZBAXXKPHQDQ-UHFFFAOYSA-N |
| SMILES | COc1ccnc2c1ccn2S(=O)(=O)c1ccc(C)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
1H-Pyrrolo[2,3-... CAS#:348640-52-8 |
| Literature: Cox, Paul J.; Majid, Tahir N.; Lai, Justine Y.Q.; Morley, Andrew D.; Amendola, Shelley; Deprets, Stephanie D.; Edlin, Christopher Patent: US2004/9983 A1, 2004 ; Location in patent: Page/Page column 114-115 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-methoxy-1-(toluene-4-sulfonyl)-1H-pyrrolo[2,3-b]pyridine |
| 4-methoxy-1-(phenylsulfonyl)pyrrolo[2,3-b]pyridine |
| 1-(Phenylsulphonyl)-4-Methoxy-7-azaindole |