niclosamide piperazine salt structure
|
Common Name | niclosamide piperazine salt | ||
|---|---|---|---|---|
| CAS Number | 34892-17-6 | Molecular Weight | 413.255 | |
| Density | N/A | Boiling Point | 424.5ºC at 760 mmHg | |
| Molecular Formula | C17H18Cl2N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.5ºC | |
| Name | niclosamide piperazine salt |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 424.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H18Cl2N4O4 |
| Molecular Weight | 413.255 |
| Flash Point | 210.5ºC |
| Exact Mass | 412.070496 |
| PSA | 119.21000 |
| LogP | 4.29250 |
| InChIKey | IAIUNINVFIUGNZ-UHFFFAOYSA-N |
| SMILES | C1CNCCN1.O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(Cl)ccc1O |
| 5-chloro-N-(2-chloro-4-nitrophenyl)salicylamide,compound with piperazine |
| 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide/piperazine,(1:x) |
| N-[2-Chloro-4-nitrophenyl]-5-chlorsalicylamide piperazine |
| 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide - piperazine (1:1) |
| Benzamide, 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-, compd. with piperazine (1:1) |