niclosamide piperazine salt
niclosamide piperazine salt structure
|
Common Name | niclosamide piperazine salt | ||
|---|---|---|---|---|
| CAS Number | 34892-17-6 | Molecular Weight | 413.255 | |
| Density | N/A | Boiling Point | 424.5ºC at 760 mmHg | |
| Molecular Formula | C17H18Cl2N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.5ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | niclosamide piperazine salt |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Boiling Point | 424.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H18Cl2N4O4 |
| Molecular Weight | 413.255 |
| Flash Point | 210.5ºC |
| Exact Mass | 412.070496 |
| PSA | 119.21000 |
| LogP | 4.29250 |
| InChIKey | IAIUNINVFIUGNZ-UHFFFAOYSA-N |
| SMILES | C1CNCCN1.O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(Cl)ccc1O |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 5-chloro-N-(2-chloro-4-nitrophenyl)salicylamide,compound with piperazine |
| 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide/piperazine,(1:x) |
| N-[2-Chloro-4-nitrophenyl]-5-chlorsalicylamide piperazine |
| 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide - piperazine (1:1) |
| Benzamide, 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-, compd. with piperazine (1:1) |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of niclosamide piperazine salt? |
| A: Boiling point of niclosamide piperazine salt is 424.5ºC at 760 mmHg. |
| Q: What is the SMILES notation of niclosamide piperazine salt? |
| A: SMILES notation of niclosamide piperazine salt is C1CNCCN1.O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(Cl)ccc1O. |
| Q: What is the molecular formula of niclosamide piperazine salt? |
| A: Molecular formula of niclosamide piperazine salt is C17H18Cl2N4O4. |
| Q: What is the InChIKey of niclosamide piperazine salt? |
| A: InChIKey of niclosamide piperazine salt is IAIUNINVFIUGNZ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of niclosamide piperazine salt? |
| A: Molecular weight of niclosamide piperazine salt is 413.255. |
| Q: What is the polar surface area (PSA) of niclosamide piperazine salt? |
| A: Polar surface area (PSA) of niclosamide piperazine salt is 119.21000. |
| Q: What English synonyms does niclosamide piperazine salt have? |
| A: English synonyms of niclosamide piperazine salt: 5-chloro-N-(2-chloro-4-nitrophenyl)salicylamide,compound with piperazine, 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide/piperazine,(1:x), N-[2-Chloro-4-nitrophenyl]-5-chlorsalicylamide piperazine, 5-Chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide - piperazine (1:1), Benzamide, 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxy-, compd. with piperazine (1:1). |
| Q: What is the CAS number of niclosamide piperazine salt? |
| A: CAS number of niclosamide piperazine salt is 34892-17-6. |
| Q: What is the English name of niclosamide piperazine salt? |
| A: The English name of niclosamide piperazine salt is niclosamide piperazine salt. |
| Q: What is the LogP of niclosamide piperazine salt? |
| A: LogP of niclosamide piperazine salt is 4.29250. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |