Benz[a]anthracene, compd. with 1,3,5-trinitrobenzene (1:1) structure
|
Common Name | Benz[a]anthracene, compd. with 1,3,5-trinitrobenzene (1:1) | ||
|---|---|---|---|---|
| CAS Number | 34892-82-5 | Molecular Weight | 441.39200 | |
| Density | N/A | Boiling Point | 436.7ºC at 760 mmHg | |
| Molecular Formula | C24H15N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.1ºC | |
| Name | benzo[a]anthracene,1,3,5-trinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 436.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C24H15N3O6 |
| Molecular Weight | 441.39200 |
| Flash Point | 209.1ºC |
| Exact Mass | 441.09600 |
| PSA | 137.46000 |
| LogP | 8.12700 |
| InChIKey | LBLNFXPWTYUCHN-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1.c1ccc2cc3c(ccc4ccccc43)cc2c1 |
|
~%
Benz[a]anthrace... CAS#:34892-82-5 |
| Literature: Casellato, Fulvia; Mascherpa, Achille; Turrio, Luigi; Girelli, Alberto Gazzetta Chimica Italiana, 1980 , vol. 110, # 11/12 p. 587 - 592 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benz[a]anthracen,Verbindung mit 1,3,5-Trinitro-benzol |
| benz[a]anthracene,compound with 1,3,5-trinitro-benzene |