Ethanimidamide,2-amino-N,N'-bis(2-fluorophenyl)-2-thioxo- structure
|
Common Name | Ethanimidamide,2-amino-N,N'-bis(2-fluorophenyl)-2-thioxo- | ||
|---|---|---|---|---|
| CAS Number | 349-19-9 | Molecular Weight | 291.31900 | |
| Density | 1.31g/cm3 | Boiling Point | 415.2ºC at 760mmHg | |
| Molecular Formula | C14H11F2N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.9ºC | |
| Name | 2-(2-fluoroanilino)-2-(2-fluorophenyl)iminoethanethioamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 415.2ºC at 760mmHg |
| Molecular Formula | C14H11F2N3S |
| Molecular Weight | 291.31900 |
| Flash Point | 204.9ºC |
| Exact Mass | 291.06400 |
| PSA | 82.50000 |
| LogP | 4.16630 |
| Index of Refraction | 1.611 |
| InChIKey | PCBJJMLZQNJQAF-UHFFFAOYSA-N |
| SMILES | NC(=S)C(=Nc1ccccc1F)Nc1ccccc1F |
|
~%
Ethanimidamide,... CAS#:349-19-9 |
| Literature: Roe; Teague Journal of the American Chemical Society, 1949 , vol. 71, p. 4019 |
|
~%
Ethanimidamide,... CAS#:349-19-9 |
| Literature: Roe; Teague Journal of the American Chemical Society, 1949 , vol. 71, p. 4019 |
|
~%
Ethanimidamide,... CAS#:349-19-9 |
| Literature: Roe; Teague Journal of the American Chemical Society, 1949 , vol. 71, p. 4019 |
| N-(2-fluoro-phenyl)-2-thio-oxalomonoimidic acid-1-(2-fluoro-anilid)-2-amide |
| C-[N.N'-Bis-(2-fluor-phenyl)-carbamimidoyl]-thioformamid |
| N-(2-Fluor-phenyl)-2-thio-oxalomonoimidsaeure-1-(2-fluor-anilid)-2-amid |