4-acetamido-3-fluorobenzene-1-sulfonyl chloride structure
|
Common Name | 4-acetamido-3-fluorobenzene-1-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 349-71-3 | Molecular Weight | 251.66200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H7ClFNO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Acetamido-3-fluorobenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H7ClFNO3S |
|---|---|
| Molecular Weight | 251.66200 |
| Exact Mass | 250.98200 |
| PSA | 75.11000 |
| LogP | 3.44190 |
| InChIKey | CTELCYFLRNFINY-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Cl)cc1F |
| HS Code | 2924299090 |
|---|
|
~%
4-acetamido-3-f... CAS#:349-71-3 |
| Literature: Astrazeneca AB Patent: US6667342 B1, 2003 ; Location in patent: Page column 70-71 ; US 6667342 B1 |
|
~%
4-acetamido-3-f... CAS#:349-71-3 |
| Literature: Boehringer Ingelheim Vetmedica GmbH Patent: US4624960 A1, 1986 ; |
|
~%
4-acetamido-3-f... CAS#:349-71-3 |
| Literature: Patel, Pratik R.; Ramalingan, Chennan; Park, Yong-Tae Bioorganic and Medicinal Chemistry Letters, 2007 , vol. 17, # 23 p. 6610 - 6614 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-acetyl-2-fluoro-4-chlorosulphonylaniline |
| 4-chlorosulfonyl-2-fluoroacetanilide |
| 4-acetamido-3-fluorobenzene-1-sulfonyl chloride |
| 3-fluoro-4-acetamidobenzene sulfonylchloride |
| 4-(ACETYLAMINO)-3-FLUOROBENZENESULFONYL CHLORIDE |