3-(2-hydroxyethyl)-1-[3-(trifluoromethyl)phenyl]quinazoline-2,4-dione structure
|
Common Name | 3-(2-hydroxyethyl)-1-[3-(trifluoromethyl)phenyl]quinazoline-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 34929-08-3 | Molecular Weight | 350.29200 | |
| Density | 1.434g/cm3 | Boiling Point | 490ºC at 760mmHg | |
| Molecular Formula | C17H13F3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.1ºC | |
| Name | 3-(2-hydroxyethyl)-1-[3-(trifluoromethyl)phenyl]quinazoline-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 490ºC at 760mmHg |
| Molecular Formula | C17H13F3N2O3 |
| Molecular Weight | 350.29200 |
| Flash Point | 250.1ºC |
| Exact Mass | 350.08800 |
| PSA | 64.23000 |
| LogP | 2.16350 |
| Index of Refraction | 1.582 |
| InChIKey | YKVDSZPXGNPCRO-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2n(-c2cccc(C(F)(F)F)c2)c(=O)n1CCO |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(2-hydroxy-ethyl)-1-(3-trifluoromethyl-phenyl)-1H-quinazoline-2,4-dione |
| Thiourea,N-(2-hydroxyethyl)-N'-(1-phenylethyl) |
| 3-(2-hydroxyethyl)-1-(1-phenylethyl)thiourea |