N-(2-nitrophenyl)benzenecarboximidoyl chloride structure
|
Common Name | N-(2-nitrophenyl)benzenecarboximidoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 3493-72-9 | Molecular Weight | 260.67600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-nitrophenyl)benzenecarboximidoyl chloride |
|---|
| Molecular Formula | C13H9ClN2O2 |
|---|---|
| Molecular Weight | 260.67600 |
| Exact Mass | 260.03500 |
| PSA | 58.18000 |
| LogP | 4.43510 |
| InChIKey | WTASXZBNJZPLDT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1N=C(Cl)c1ccccc1 |
|
~%
N-(2-nitropheny... CAS#:3493-72-9 |
| Literature: Houghton, Peter G.; Pipe, David F.; Rees, Charles W. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1985 , p. 1471 - 1480 |