N-(2-Bromophenyl)-5-chloro-2-methoxybenzamide structure
|
Common Name | N-(2-Bromophenyl)-5-chloro-2-methoxybenzamide | ||
|---|---|---|---|---|
| CAS Number | 349538-99-4 | Molecular Weight | 340.60000 | |
| Density | 1.545g/cm3 | Boiling Point | 381.5ºC at 760 mmHg | |
| Molecular Formula | C14H11BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 184.5ºC | |
| Name | N-(2-Bromophenyl)-5-chloro-2-methoxybenzamide |
|---|
| Density | 1.545g/cm3 |
|---|---|
| Boiling Point | 381.5ºC at 760 mmHg |
| Molecular Formula | C14H11BrClNO2 |
| Molecular Weight | 340.60000 |
| Flash Point | 184.5ºC |
| Exact Mass | 338.96600 |
| PSA | 41.82000 |
| LogP | 4.74740 |
| Index of Refraction | 1.646 |
| InChIKey | OOPPIYWBHOTCGE-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1ccccc1Br |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |