N-(2-Bromophenyl)-4-chloro-3-nitrobenzamide structure
|
Common Name | N-(2-Bromophenyl)-4-chloro-3-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 349619-73-4 | Molecular Weight | 355.57100 | |
| Density | 1.707g/cm3 | Boiling Point | 401.6ºC at 760 mmHg | |
| Molecular Formula | C13H8BrClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
| Name | N-(2-Bromophenyl)-4-chloro-3-nitrobenzamide |
|---|
| Density | 1.707g/cm3 |
|---|---|
| Boiling Point | 401.6ºC at 760 mmHg |
| Molecular Formula | C13H8BrClN2O3 |
| Molecular Weight | 355.57100 |
| Flash Point | 196.7ºC |
| Exact Mass | 353.94100 |
| PSA | 78.41000 |
| LogP | 5.17020 |
| Index of Refraction | 1.693 |
| InChIKey | PDKNULDICXHHQW-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1Br)c1ccc(Cl)c([N+](=O)[O-])c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |