2-Oxiranemethanamine,N-(4-chlorophenyl)-N-(2-oxiranylmethyl)- structure
|
Common Name | 2-Oxiranemethanamine,N-(4-chlorophenyl)-N-(2-oxiranylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 34972-41-3 | Molecular Weight | 239.69800 | |
| Density | 1.331g/cm3 | Boiling Point | 377.3ºC at 760 mmHg | |
| Molecular Formula | C12H14ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182ºC | |
| Name | 4-chloro-N,N-bis(oxiran-2-ylmethyl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.331g/cm3 |
|---|---|
| Boiling Point | 377.3ºC at 760 mmHg |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.69800 |
| Flash Point | 182ºC |
| Exact Mass | 239.07100 |
| PSA | 28.30000 |
| LogP | 1.94400 |
| Index of Refraction | 1.619 |
| InChIKey | CEGOCWZGIDQKJH-UHFFFAOYSA-N |
| SMILES | Clc1ccc(N(CC2CO2)CC2CO2)cc1 |
|
~%
2-Oxiranemethan... CAS#:34972-41-3 |
| Literature: Homer Journal of the Chemical Society, 1950 , p. 3690 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HMS3078M08 |
| 4-Chlor-N,N-bis-oxiranylmethyl-anilin |
| 4-chloro-N,N-bis-oxiranylmethyl-aniline |