4,9-dihydroxy-3,5,8,10-tetraoxa-4,9-diphosphadodecane-1,12-diol 4,9-dioxide structure
|
Common Name | 4,9-dihydroxy-3,5,8,10-tetraoxa-4,9-diphosphadodecane-1,12-diol 4,9-dioxide | ||
|---|---|---|---|---|
| CAS Number | 34994-91-7 | Molecular Weight | 310.13300 | |
| Density | 1.62g/cm3 | Boiling Point | 521.9ºC at 760mmHg | |
| Molecular Formula | C6H16O10P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.4ºC | |
| Name | 2-hydroxyethyl 2-[hydroxy(2-hydroxyethoxy)phosphoryl]oxyethyl hydrogen phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 521.9ºC at 760mmHg |
| Molecular Formula | C6H16O10P2 |
| Molecular Weight | 310.13300 |
| Flash Point | 269.4ºC |
| Exact Mass | 310.02200 |
| PSA | 171.60000 |
| Index of Refraction | 1.504 |
| InChIKey | VZTUNSKRPZVUGG-UHFFFAOYSA-N |
| SMILES | O=P(O)(OCCO)OCCOP(=O)(O)OCCO |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| EINECS 252-311-8 |
| 4,9-dihydroxy-3,5,8,10-tetraoxa-4,9-diphosphadodecane-1,12-diol 4,9-dioxide |
| 3,5,8,10-Tetraoxa-4,9-diphosphadodecane-1,12-diol,4,9-dihydroxy-,4,9-dioxide |