N-[5-(1,1-dimethylethyl)-2-ethoxyphenyl]-N'-(2-ethylphenyl)oxamide structure
|
Common Name | N-[5-(1,1-dimethylethyl)-2-ethoxyphenyl]-N'-(2-ethylphenyl)oxamide | ||
|---|---|---|---|---|
| CAS Number | 35001-52-6 | Molecular Weight | 368.46900 | |
| Density | 1.139g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H28N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-(5-tert-butyl-2-ethoxyphenyl)-N-(2-ethylphenyl)oxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.46900 |
| Exact Mass | 368.21000 |
| PSA | 67.43000 |
| LogP | 4.66840 |
| Index of Refraction | 1.588 |
| InChIKey | ZBNMOUGFCKAGGQ-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(C)(C)C)cc1NC(=O)C(=O)Nc1ccccc1CC |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Ethanediamide,N-(5-(1,1-dimethylethyl)-2-ethoxyphenyl)-N'-(2-ethylphenyl) |
| N-[5-(1,1-dimethylethyl)-2-ethoxyphenyl]-N'-(2-ethylphenyl)oxamide |
| N-(5-tert-butyl-2-ethoxy-phenyl)-N'-(2-ethyl-phenyl)-oxalamide |
| EINECS 252-314-4 |
| N-(5-(1,1-Dimethylethyl)-2-ethoxyphenyl)-N'-(2-ethylphenyl)ethanediamide |