trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Modify Date: 2026-07-15 17:19:41
![trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane Structure](https://www.chemsrc.com/extcaspic/430/350031-03-7.png)
trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane structure
|
Common Name | trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane | ||
|---|---|---|---|---|
| CAS Number | 350031-03-7 | Molecular Weight | 208.11 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21BO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21BO2 |
|---|---|
| Molecular Weight | 208.11 |
| InChIKey | MFOCKZYRZAVWDO-VHSXEESVSA-N |
| SMILES | CC1(C)OB(C2CC2C2CC2)OC1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 350031-03-7? |
| A: Chinese name of 350031-03-7 is 350031-03-7. |
| Q: What is the InChIKey of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: InChIKey of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is MFOCKZYRZAVWDO-VHSXEESVSA-N. |
| Q: What is the SMILES notation of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: SMILES notation of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is CC1(C)OB(C2CC2C2CC2)OC1(C)C. |
| Q: What is the molecular formula of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Molecular formula of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is C12H21BO2. |
| Q: What is the CAS number of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: CAS number of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 350031-03-7. |
| Q: What is the molecular weight of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: Molecular weight of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is 208.11. |
| Q: What is the English name of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane? |
| A: The English name of trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is trans-2-([1,1'-Bi(cyclopropan)]-2-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. |