3,4,5-trimethoxy-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)benzamide structure
|
Common Name | 3,4,5-trimethoxy-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 35047-56-4 | Molecular Weight | 355.42800 | |
| Density | 1.18g/cm3 | Boiling Point | 481.1ºC at 760 mmHg | |
| Molecular Formula | C21H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.8ºC | |
| Name | 3,4,5-trimethoxy-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-yl)benzamide |
|---|
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 481.1ºC at 760 mmHg |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.42800 |
| Flash Point | 244.8ºC |
| Exact Mass | 355.17800 |
| PSA | 60.28000 |
| LogP | 4.48470 |
| Index of Refraction | 1.581 |
| InChIKey | QAYYMOACHQWLOS-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)NC2CCCCc3ccccc32)cc(OC)c1OC |
| HS Code | 2924299090 |
|---|
|
~%
3,4,5-trimethox... CAS#:35047-56-4 |
| Literature: Vejdelek,Z.J.; Protiva,M. Collection of Czechoslovak Chemical Communications, 1971 , vol. 36, p. 1611 - 1623 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |