2-[(2-bromo-1,3-thiazol-5-yl)sulfanylmethyl]-5-tert-butyl-1,3-oxazole structure
|
Common Name | 2-[(2-bromo-1,3-thiazol-5-yl)sulfanylmethyl]-5-tert-butyl-1,3-oxazole | ||
|---|---|---|---|---|
| CAS Number | 350511-08-9 | Molecular Weight | 333.26800 | |
| Density | 1.53g/cm3 | Boiling Point | 391.4ºC at 760 mmHg | |
| Molecular Formula | C11H13BrN2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.5ºC | |
| Name | 2-[(2-bromo-1,3-thiazol-5-yl)sulfanylmethyl]-5-tert-butyl-1,3-oxazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 391.4ºC at 760 mmHg |
| Molecular Formula | C11H13BrN2OS2 |
| Molecular Weight | 333.26800 |
| Flash Point | 190.5ºC |
| Exact Mass | 331.96500 |
| PSA | 92.46000 |
| LogP | 4.48340 |
| Index of Refraction | 1.622 |
| InChIKey | PWNRQULKRBVIPO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1cnc(CSc2cnc(Br)s2)o1 |
|
~41%
2-[(2-bromo-1,3... CAS#:350511-08-9 |
| Literature: Misra, Raj N.; Xiao, Hai-Yun; Williams, David K.; Kim, Kyoung S.; Lu, Songfeng; Keller, Kristen A.; Mulheron, Janet G.; Batorsky, Roberta; Tokarski, John S.; Sack, John S.; Kimball, S. David; Lee, Francis Y.; Webster, Kevin R. Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 11 p. 2973 - 2977 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2-((2-Bromothiazol-5-ylthio)-methyl)-5-tert-butyloxazole |
| QC-8285 |
| AC-7889 |