2-[bis(2-prop-2-enoyloxyethoxy)phosphanyloxy]ethyl prop-2-enoate structure
|
Common Name | 2-[bis(2-prop-2-enoyloxyethoxy)phosphanyloxy]ethyl prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 35057-49-9 | Molecular Weight | 376.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[bis(2-prop-2-enoyloxyethoxy)phosphanyloxy]ethyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H21O9P |
|---|---|
| Molecular Weight | 376.29600 |
| Exact Mass | 376.09200 |
| PSA | 120.18000 |
| LogP | 1.45070 |
| InChIKey | YQZZHMXSIYMFDK-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCCOP(=O)(OCCOC(=O)C=C)OCCOC(=O)C=C |
| HS Code | 2931900090 |
|---|
|
~%
2-[bis(2-prop-2... CAS#:35057-49-9 |
| Literature: Xing, Weiyi; Jie, Ganxin; Song, Lei; Hu, Shuang; Lv, Xiaoqi; Wang, Xin; Hu, Yuan Thermochimica Acta, 2011 , vol. 513, # 1-2 p. 75 - 82 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| einecs 252-340-6 |