[4-(4-chlorophenyl)butan-2-ylideneamino]urea structure
|
Common Name | [4-(4-chlorophenyl)butan-2-ylideneamino]urea | ||
|---|---|---|---|---|
| CAS Number | 3506-76-1 | Molecular Weight | 239.70100 | |
| Density | 1.24g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H14ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(4-chlorophenyl)butan-2-ylideneamino]urea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Molecular Formula | C11H14ClN3O |
| Molecular Weight | 239.70100 |
| Exact Mass | 239.08300 |
| PSA | 67.48000 |
| LogP | 3.40800 |
| Index of Refraction | 1.576 |
| InChIKey | SLZBUWSNKAOEMT-ZSOIEALJSA-N |
| SMILES | CC(CCc1ccc(Cl)cc1)=NNC(N)=O |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-Chlor-benzylaceton-semicarbazon |