4-[(4-aminophenyl)butylamino]butane-1-sulphonic acid structure
|
Common Name | 4-[(4-aminophenyl)butylamino]butane-1-sulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 35079-64-2 | Molecular Weight | 300.41700 | |
| Density | 1.214g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H24N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(4-amino-N-butylanilino)butane-1-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.214g/cm3 |
|---|---|
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.41700 |
| Exact Mass | 300.15100 |
| PSA | 92.01000 |
| LogP | 4.20530 |
| Index of Refraction | 1.574 |
| InChIKey | CSGNEKGWOJHKOI-UHFFFAOYSA-N |
| SMILES | CCCCN(CCCCS(=O)(=O)O)c1ccc(N)cc1 |
| HS Code | 2921590090 |
|---|
| HS Code | 2921590090 |
|---|---|
| Summary | 2921590090. other aromatic polyamines and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| einecs 252-350-0 |