ethyl 2-acetyl-2-allylpent-4-ene-1-oate structure
|
Common Name | ethyl 2-acetyl-2-allylpent-4-ene-1-oate | ||
|---|---|---|---|---|
| CAS Number | 3508-77-8 | Molecular Weight | 210.27000 | |
| Density | 0.966g/cm3 | Boiling Point | 265.7ºC at 760mmHg | |
| Molecular Formula | C12H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 109.1ºC | |
| Name | ethyl 2-acetyl-2-prop-2-enylpent-4-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.966g/cm3 |
|---|---|
| Boiling Point | 265.7ºC at 760mmHg |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27000 |
| Flash Point | 109.1ºC |
| Exact Mass | 210.12600 |
| PSA | 43.37000 |
| LogP | 2.27710 |
| Index of Refraction | 1.453 |
| InChIKey | IOZNORWPBHWYBA-UHFFFAOYSA-N |
| SMILES | C=CCC(CC=C)(C(C)=O)C(=O)OCC |
| HS Code | 2918300090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 5 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Ethyl 2-acetyl-2-allylpent-4-ene-1-oate |
| 2-Acetyl-2-allyl-pent-4-ensaeure-aethylester |
| EINECS 222-508-3 |
| ethyl 2-acetyl-2-allylpent-4-enoate |
| 2-Acetyl-2-allylpent-4-enoic acid,ethyl ester |